144.00 GBP valid until 2025-12-31
Use promo code "25339" to get your promotional price.
Use promo code "25339" to get your promotional price.
Quantity | 5 g |
---|
CAS | 99747-74-7 |
---|---|
Molecular Formula | C11H7F3O3S |
Molecular Weight (g/mol) | 276.229 |
MDL Number | MFCD00192340 |
InChI Key | WQWUQDVFRYMMCY-UHFFFAOYSA-N |
Synonym | 1-naphthyl trifluoromethanesulfonate,1-naphthyl triflate,1-naphthyl-triflate,1-naphthalenyl triflate,acmc-20aot0,1-trifluoromethanesulfonyl naphthalene |
PubChem CID | 378884 |
IUPAC Name | naphthalen-1-yl trifluoromethanesulfonate |
SMILES | C1=CC=C2C(=C1)C=CC=C2OS(=O)(=O)C(F)(F)F |
Chemical Name or Material | 1-Naphthyl trifluoromethanesulfonate |
---|---|
CAS | 99747-74-7 |
Color | Red |
Density | 1.405 g/mL |
Boiling Point | 97°C to 98°C (0.3 mmHg) |
Flash Point | 113°C (235°F) |
Molecular Formula | C11H7F3O3S |
Refractive Index | 1.52 |
MDL Number | MFCD00192340 |
Quantity | 5 g |
UN Number | UN3265 |
Synonym | 1-naphthyl trifluoromethanesulfonate,1-naphthyl triflate,1-naphthyl-triflate,1-naphthalenyl triflate,acmc-20aot0,1-trifluoromethanesulfonyl naphthalene |
Synonym | 1-naphthyl trifluoromethanesulfonate,1-naphthyl triflate,1-naphthyl-triflate,1-naphthalenyl triflate,acmc-20aot0,1-trifluoromethanesulfonyl naphthalene |
Synonym | 1-naphthyl trifluoromethanesulfonate,1-naphthyl triflate,1-naphthyl-triflate,1-naphthalenyl triflate,acmc-20aot0,1-trifluoromethanesulfonyl naphthalene |
Synonym | 1-naphthyl trifluoromethanesulfonate,1-naphthyl triflate,1-naphthyl-triflate,1-naphthalenyl triflate,acmc-20aot0,1-trifluoromethanesulfonyl naphthalene |
Synonym | 1-naphthyl trifluoromethanesulfonate,1-naphthyl triflate,1-naphthyl-triflate,1-naphthalenyl triflate,acmc-20aot0,1-trifluoromethanesulfonyl naphthalene |
Synonym | 1-naphthyl trifluoromethanesulfonate,1-naphthyl triflate,1-naphthyl-triflate,1-naphthalenyl triflate,acmc-20aot0,1-trifluoromethanesulfonyl naphthalene |
InChI Key | WQWUQDVFRYMMCY-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC=C2OS(=O)(=O)C(F)(F)F |
IUPAC Name | naphthalen-1-yl trifluoromethanesulfonate |
Molecular Weight (g/mol) | 276.229 |
PubChem CID | 378884 |
Formula Weight | 276.23 |
Percent Purity | 97% |
Physical Form | Liquid |